Products 1356930-28-3
CAS 1356930-28-3 is the registry number for N-Formyl-L-leucine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(2S)-5,5,5-trideuterio-2-formamido-4-methylpentanoic acid (CAS 1356930-28-3) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 162.20 g/mol. IUPAC name: (2S)-5,5,5-trideuterio-2-formamido-4-methylpentanoic acid. InChIKey: HFBHOAHFRNLZGN-PIRDCUBLSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 162.20 g/mol |
| IUPAC name | (2S)-5,5,5-trideuterio-2-formamido-4-methylpentanoic acid |
| InChIKey | HFBHOAHFRNLZGN-PIRDCUBLSA-N |
| SMILES | [2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)