CAS 1357066-21-7 appears in our catalog under these names: Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(1,4-phenylene))end capped with dimethylphenyl, 10–(4,6–Diphenyl–1,3,5–triazin–2–yl)–10H–phenoxazine. Offered by: Lumtec, GLPBio. Available pack sizes: On request, 1g.
10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxazine (CAS 1357066-21-7) is a chemical compound with the molecular formula C27H18N4O and a molecular weight of 414.5 g/mol. IUPAC name: 10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxazine. InChIKey: ITKOYYRLOGYUQY-UHFFFAOYSA-N.
| Molecular formula | C27H18N4O |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxazine |
| InChIKey | ITKOYYRLOGYUQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)N3C4=CC=CC=C4OC5=CC=CC=C53)C6=CC=CC=C6 |
Computed by PubChem (NCBI)