CAS 1357072-61-7 appears in our catalog under these names: c-Met inhibitor 1/ 99.56% (existing batch purity), c-Met inhibitor 1 98%, c-Met inhibitor 1, 98%, 98%, c-Met inhibitor 1, 98.89%, 6-(1-METHYL-1H-PYRAZOL-4-YL)-3-((2-METHYL-2H-INDAZOL-5-YL)THIO)-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZINE, 99%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 2mg.
3-(2-methylindazol-5-yl)sulfanyl-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1357072-61-7) is a chemical compound with the molecular formula C17H14N8S and a molecular weight of 362.4 g/mol. IUPAC name: 3-(2-methylindazol-5-yl)sulfanyl-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: JYXHZDNTBJUJNH-UHFFFAOYSA-N.
| Molecular formula | C17H14N8S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 3-(2-methylindazol-5-yl)sulfanyl-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | JYXHZDNTBJUJNH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NN3C(=NN=C3SC4=CC5=CN(N=C5C=C4)C)C=C2 |
Computed by PubChem (NCBI)