Products 1357097-03-0
CAS 1357097-03-0 is the registry number for 3-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridine 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium (CAS 1357097-03-0) is a chemical compound with the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. IUPAC name: 3-chloro-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium. InChIKey: OEHMIGFYIBYDQD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | 3-chloro-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium |
| InChIKey | OEHMIGFYIBYDQD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)[N+](=CC(=C2)Cl)[O-] |
Computed by PubChem (NCBI)