CAS 13571-44-3 appears in our catalog under these names: VPC-70063, 98%, VPC-70063/ 99.93% (existing batch purity), VPC–70063, VPC-70063 98%, VPC-70063. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 25mg, 10mg, 5mg, 50mg, 100mg, 500mg, 250mg.
1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]thiourea (CAS 13571-44-3) is a chemical compound with the molecular formula C16H12F6N2S and a molecular weight of 378.3 g/mol. IUPAC name: 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]thiourea. InChIKey: PIQMVCPITQIXGJ-UHFFFAOYSA-N.
| Molecular formula | C16H12F6N2S |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]thiourea |
| InChIKey | PIQMVCPITQIXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=S)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)