Products 1357103-67-3
CAS 1357103-67-3 is the registry number for 1,5-Dibromo-3-fluoro-2-methoxy-4-methylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1,5-dibromo-3-fluoro-2-methoxy-4-methylbenzene (CAS 1357103-67-3) is a chemical compound with the molecular formula C8H7Br2FO and a molecular weight of 297.95 g/mol. IUPAC name: 1,5-dibromo-3-fluoro-2-methoxy-4-methylbenzene. InChIKey: XNDSPFMTMZMAFU-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2FO |
|---|---|
| Molecular weight | 297.95 g/mol |
| IUPAC name | 1,5-dibromo-3-fluoro-2-methoxy-4-methylbenzene |
| InChIKey | XNDSPFMTMZMAFU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Br)Br)OC)F |
Computed by PubChem (NCBI)