Products 135729-73-6
CAS 135729-73-6 is the registry number for Palonosetron Impurity 1 Monomer. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3aR)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one (CAS 135729-73-6) is a chemical compound with the molecular formula C19H24N2O and a molecular weight of 296.4 g/mol. IUPAC name: (3aR)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one. InChIKey: CPZBLNMUGSZIPR-DOTOQJQBSA-N.
| Molecular formula | C19H24N2O |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (3aR)-2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one |
| InChIKey | CPZBLNMUGSZIPR-DOTOQJQBSA-N |
| SMILES | C1C[C@H]2CN(C(=O)C3=CC=CC(=C23)C1)[C@@H]4CN5CCC4CC5 |
Computed by PubChem (NCBI)