Products 1357352-51-2

CAS 1357352-51-2 appears in our catalog under these names: (1,3-Thiazol-4-ylmethyl)amine dihydrochloride, 95%, (1,3-Thiazol-4-ylmethyl)amine dihydrochloride, Thiazol-4-ylmethanamine dihydrochloride 95%, (1,3-thiazol-4-ylmethyl)amine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 100mg, 500mg.

Structural formula: {0} (CAS {1})

1,3-thiazol-4-ylmethanamine;dihydrochloride (CAS 1357352-51-2) is a chemical compound with the molecular formula C4H8Cl2N2S and a molecular weight of 187.09 g/mol. IUPAC name: 1,3-thiazol-4-ylmethanamine;dihydrochloride. InChIKey: NYVCJGCAUXCGNH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8Cl2N2S
Molecular weight187.09 g/mol
IUPAC name1,3-thiazol-4-ylmethanamine;dihydrochloride
InChIKeyNYVCJGCAUXCGNH-UHFFFAOYSA-N
SMILESC1=C(N=CS1)CN.Cl.Cl

Computed by PubChem (NCBI)