CAS 1357362-67-4 is the registry number for NOSH-aspirin. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutanoyloxy)benzoate (CAS 1357362-67-4) is a chemical compound with the molecular formula C20H15NO7S3 and a molecular weight of 477.5 g/mol. IUPAC name: [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutanoyloxy)benzoate. InChIKey: CEDNXFMUAHDZQB-UHFFFAOYSA-N.
| Molecular formula | C20H15NO7S3 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-(4-nitrooxybutanoyloxy)benzoate |
| InChIKey | CEDNXFMUAHDZQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OC2=CC=C(C=C2)C3=CC(=S)SS3)OC(=O)CCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)