Products 135742-47-1
CAS 135742-47-1 appears in our catalog under these names: 2,6-Dimethylpyridine-d9, 98 atom % D, min 98% Chemical Purity, 2，6–DIMETHYLPYRIDINE–D9. Offered by: CDN, GLPBio. Available pack sizes: 1g, 0,5g, 10mg.
3,4,5-trideuterio-2,6-bis(trideuteriomethyl)pyridine (CAS 135742-47-1) is a chemical compound with the molecular formula C7H9N and a molecular weight of 116.21 g/mol. IUPAC name: 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)pyridine. InChIKey: OISVCGZHLKNMSJ-XVGWXEQOSA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 116.21 g/mol |
| IUPAC name | 3,4,5-trideuterio-2,6-bis(trideuteriomethyl)pyridine |
| InChIKey | OISVCGZHLKNMSJ-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)