CAS 135748-33-3 appears in our catalog under these names: 2,4-Dichloro-5-fluorobenzamide, 95%, 2,4-Dichloro-5-fluorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,4-dichloro-5-fluorobenzamide (CAS 135748-33-3) is a chemical compound with the molecular formula C7H4Cl2FNO and a molecular weight of 208.01 g/mol. IUPAC name: 2,4-dichloro-5-fluorobenzamide. InChIKey: SKSVSZRFINHARI-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2FNO |
|---|---|
| Molecular weight | 208.01 g/mol |
| IUPAC name | 2,4-dichloro-5-fluorobenzamide |
| InChIKey | SKSVSZRFINHARI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)