CAS 1357559-51-3 appears in our catalog under these names: Cyclosporin Impurity 6, potassium trifluoro(3-(4-methylpiperazin-1-yl)prop-1-en-2-yl)borate. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[3-(4-methylpiperazin-1-yl)prop-1-en-2-yl]boranuide (CAS 1357559-51-3) is a chemical compound with the molecular formula C8H15BF3KN2 and a molecular weight of 246.13 g/mol. IUPAC name: potassium trifluoro-[3-(4-methylpiperazin-1-yl)prop-1-en-2-yl]boranuide. InChIKey: RUBVPGQUMRUXSB-UHFFFAOYSA-N.
| Molecular formula | C8H15BF3KN2 |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | potassium trifluoro-[3-(4-methylpiperazin-1-yl)prop-1-en-2-yl]boranuide |
| InChIKey | RUBVPGQUMRUXSB-UHFFFAOYSA-N |
| SMILES | [B-](C(=C)CN1CCN(CC1)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)