CAS 1357572-67-8 is the registry number for 9-Bromo-7-phenyl-7H-benzo[c]carbazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g.
9-bromo-7-phenylbenzo[c]carbazole (CAS 1357572-67-8) is a chemical compound with the molecular formula C22H14BrN and a molecular weight of 372.3 g/mol. IUPAC name: 9-bromo-7-phenylbenzo[c]carbazole. InChIKey: SCFYLUFGTCXFSI-UHFFFAOYSA-N.
| Molecular formula | C22H14BrN |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | 9-bromo-7-phenylbenzo[c]carbazole |
| InChIKey | SCFYLUFGTCXFSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C4=C2C=C(C=C4)Br)C5=CC=CC=C5C=C3 |
Computed by PubChem (NCBI)