CAS 1357580-36-9 is the registry number for 2,5-Dibromo-4-(pyridin-4-yl)thiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dibromo-4-pyridin-4-yl-1,3-thiazole (CAS 1357580-36-9) is a chemical compound with the molecular formula C8H4Br2N2S and a molecular weight of 320.01 g/mol. IUPAC name: 2,5-dibromo-4-pyridin-4-yl-1,3-thiazole. InChIKey: GEUQQIRJFZIZGX-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2S |
|---|---|
| Molecular weight | 320.01 g/mol |
| IUPAC name | 2,5-dibromo-4-pyridin-4-yl-1,3-thiazole |
| InChIKey | GEUQQIRJFZIZGX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=C(SC(=N2)Br)Br |
Computed by PubChem (NCBI)