CAS 13577-26-9 appears in our catalog under these names: 6,7-Dibromo-1h,3h-benzo[de]isochromene-1,3-dione, 95%, 6,7-dibromo-1H,3H-benzo(de)isochromene-1,3-dione, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g.
8,10-dibromo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione (CAS 13577-26-9) is a chemical compound with the molecular formula C12H4Br2O3 and a molecular weight of 355.97 g/mol. IUPAC name: 8,10-dibromo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione. InChIKey: HJUUAJMSVJJHQP-UHFFFAOYSA-N.
| Molecular formula | C12H4Br2O3 |
|---|---|
| Molecular weight | 355.97 g/mol |
| IUPAC name | 8,10-dibromo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione |
| InChIKey | HJUUAJMSVJJHQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=CC=C3C2=C1C(=O)OC3=O)Br)Br |
Computed by PubChem (NCBI)