Products 1357954-34-7
CAS 1357954-34-7 appears in our catalog under these names: Plasma kallikrein–IN–4, Plasma kallikrein-IN-4, Plasma kallikrein-IN-4, 98.61%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 5 mg, 10 mg.
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide (CAS 1357954-34-7) is a chemical compound with the molecular formula C22H23N7O and a molecular weight of 401.5 g/mol. IUPAC name: N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide. InChIKey: BYZNGWXDOMLVBH-UHFFFAOYSA-N.
| Molecular formula | C22H23N7O |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide |
| InChIKey | BYZNGWXDOMLVBH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2)CN3C=C(N=N3)C(=O)NCC4=C(N=C(C=C4C)N)C |
Computed by PubChem (NCBI)