CAS 135808-66-1 is the registry number for 3,5-DIMETHOXYBENZYLMAGNESIUM CHLORIDE, &. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Magnesium;1-methanidyl-3,5-dimethoxybenzene;chloride (CAS 135808-66-1) is a chemical compound with the molecular formula C9H11ClMgO2 and a molecular weight of 210.94 g/mol. IUPAC name: magnesium;1-methanidyl-3,5-dimethoxybenzene;chloride. InChIKey: TYDWBLYJIGSBPU-UHFFFAOYSA-M.
| Molecular formula | C9H11ClMgO2 |
|---|---|
| Molecular weight | 210.94 g/mol |
| IUPAC name | magnesium;1-methanidyl-3,5-dimethoxybenzene;chloride |
| InChIKey | TYDWBLYJIGSBPU-UHFFFAOYSA-M |
| SMILES | COC1=CC(=CC(=C1)[CH2-])OC.[Mg+2].[Cl-] |
Computed by PubChem (NCBI)