CAS 1358101-24-2 is the registry number for N-(4-Chlorobenzyl)-2-methoxypyrimidine-5-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
N-[(4-chlorophenyl)methyl]-2-methoxypyrimidine-5-carboxamide (CAS 1358101-24-2) is a chemical compound with the molecular formula C13H12ClN3O2 and a molecular weight of 277.70 g/mol. IUPAC name: N-[(4-chlorophenyl)methyl]-2-methoxypyrimidine-5-carboxamide. InChIKey: NYEOBJDCDPAIHV-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3O2 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | N-[(4-chlorophenyl)methyl]-2-methoxypyrimidine-5-carboxamide |
| InChIKey | NYEOBJDCDPAIHV-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=N1)C(=O)NCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)