Products 135812-04-3
CAS 135812-04-3 is the registry number for UC-84. Offered by: MedChemExpress. Available pack sizes: Get quote.
Propan-2-yl 2-chloro-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate (CAS 135812-04-3) is a chemical compound with the molecular formula C16H18ClNO4S and a molecular weight of 355.8 g/mol. IUPAC name: propan-2-yl 2-chloro-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate. InChIKey: FMQGUMRNTBJHEA-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO4S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | propan-2-yl 2-chloro-5-[(6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl)amino]benzoate |
| InChIKey | FMQGUMRNTBJHEA-UHFFFAOYSA-N |
| SMILES | CC1=C(SCCO1)C(=O)NC2=CC(=C(C=C2)Cl)C(=O)OC(C)C |
Computed by PubChem (NCBI)