CAS 135812-34-9 is the registry number for UC-38. Offered by: MedChemExpress. Available pack sizes: Get quote.
Propan-2-yl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate (CAS 135812-34-9) is a chemical compound with the molecular formula C14H18ClNO3S and a molecular weight of 315.8 g/mol. IUPAC name: propan-2-yl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate. InChIKey: AXTNFJKQZPETJA-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3S |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | propan-2-yl 2-chloro-5-(propan-2-yloxycarbothioylamino)benzoate |
| InChIKey | AXTNFJKQZPETJA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=CC(=C1)NC(=S)OC(C)C)Cl |
Computed by PubChem (NCBI)