CAS 1358201-44-1 is the registry number for P162-0948. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(4-fluorophenyl)methyl]-2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)acetamide (CAS 1358201-44-1) is a chemical compound with the molecular formula C20H15FN4O2 and a molecular weight of 362.4 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)acetamide. InChIKey: PFQAFOZMVLHHBM-UHFFFAOYSA-N.
| Molecular formula | C20H15FN4O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-2-(5-quinolin-6-yl-1,3,4-oxadiazol-2-yl)acetamide |
| InChIKey | PFQAFOZMVLHHBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=NN=C(O3)CC(=O)NCC4=CC=C(C=C4)F)N=C1 |
Computed by PubChem (NCBI)