CAS 1358676-24-0 is the registry number for 2-Amino-6,8-dihydroxypurine-15N5. Offered by: TRC. Available pack sizes: 25mg.
2-(15N)azanyl-7,9-dihydro-1H-purine-6,8-dione (CAS 1358676-24-0) is a chemical compound with the molecular formula C5H5N5O2 and a molecular weight of 172.09 g/mol. IUPAC name: 2-(15N)azanyl-7,9-dihydro-1H-purine-6,8-dione. InChIKey: CLGFIVUFZRGQRP-CIKZIQIKSA-N.
| Molecular formula | C5H5N5O2 |
|---|---|
| Molecular weight | 172.09 g/mol |
| IUPAC name | 2-(15N)azanyl-7,9-dihydro-1H-purine-6,8-dione |
| InChIKey | CLGFIVUFZRGQRP-CIKZIQIKSA-N |
| SMILES | C12=C([15NH]C(=O)[15NH]1)[15N]=C([15NH]C2=O)[15NH2] |
Computed by PubChem (NCBI)