Products 1358756-00-9
CAS 1358756-00-9 is the registry number for 7-Diethylamino-6'-bromo-3,3'-carbonylbiscoumarine, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-(6-bromo-2-oxochromene-3-carbonyl)-7-(diethylamino)chromen-2-one (CAS 1358756-00-9) is a chemical compound with the molecular formula C23H18BrNO5 and a molecular weight of 468.3 g/mol. IUPAC name: 3-(6-bromo-2-oxochromene-3-carbonyl)-7-(diethylamino)chromen-2-one. InChIKey: OAQHYDJTSRSGRI-UHFFFAOYSA-N.
| Molecular formula | C23H18BrNO5 |
|---|---|
| Molecular weight | 468.3 g/mol |
| IUPAC name | 3-(6-bromo-2-oxochromene-3-carbonyl)-7-(diethylamino)chromen-2-one |
| InChIKey | OAQHYDJTSRSGRI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)C3=CC4=C(C=CC(=C4)Br)OC3=O |
Computed by PubChem (NCBI)