Products 135897-06-2
CAS 135897-06-2 appears in our catalog under these names: SB 218078, SB-218078, SB 218078, SB 218078, 98%, 98%, SB-218078, 98.30%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 10 mg, 1 mg, 5 mg.
28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione (CAS 135897-06-2) is a chemical compound with the molecular formula C24H15N3O3 and a molecular weight of 393.4 g/mol. IUPAC name: 28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione. InChIKey: OTPNDVKVEAIXTI-UHFFFAOYSA-N.
| Molecular formula | C24H15N3O3 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione |
| InChIKey | OTPNDVKVEAIXTI-UHFFFAOYSA-N |
| SMILES | C1CC2N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N(C1O2)C7=C53)C(=O)NC6=O |
Computed by PubChem (NCBI)
Synonyms:
orb1706659