CAS 13590-98-2 appears in our catalog under these names: N-Desisopropyl N-Chlorophenylchlorguanide Hydrochloride, >95% (HPLC), 1,5-Bis-(4-Chlorophenyl)biguanide Hydrochloride. Offered by: TRC, Mikromol. Available pack sizes: 500mg, 5g, 25mg.
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-(4-chlorophenyl)guanidine;hydrochloride (CAS 13590-98-2) is a chemical compound with the molecular formula C14H14Cl3N5 and a molecular weight of 358.6 g/mol. IUPAC name: (1E)-1-[amino-(4-chloroanilino)methylidene]-2-(4-chlorophenyl)guanidine;hydrochloride. InChIKey: HEWJYBHXNHZDOY-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3N5 |
|---|---|
| Molecular weight | 358.6 g/mol |
| IUPAC name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-(4-chlorophenyl)guanidine;hydrochloride |
| InChIKey | HEWJYBHXNHZDOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N/C(=N/C(=NC2=CC=C(C=C2)Cl)N)/N)Cl.Cl |
Computed by PubChem (NCBI)