CAS 135911-95-4 is the registry number for (trans-2-(bromomethyl)cyclopropyl)benzene, 97%. Offered by: AmBeed. Available pack sizes: 1g.
[(1R,2R)-2-(bromomethyl)cyclopropyl]benzene (CAS 135911-95-4) is a chemical compound with the molecular formula C10H11Br and a molecular weight of 211.10 g/mol. IUPAC name: [(1R,2R)-2-(bromomethyl)cyclopropyl]benzene. InChIKey: QYDBZVRKADDLFQ-UWVGGRQHSA-N.
| Molecular formula | C10H11Br |
|---|---|
| Molecular weight | 211.10 g/mol |
| IUPAC name | [(1R,2R)-2-(bromomethyl)cyclopropyl]benzene |
| InChIKey | QYDBZVRKADDLFQ-UWVGGRQHSA-N |
| SMILES | C1[C@H]([C@@H]1C2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)