CAS 135941-84-3 appears in our catalog under these names: Boc-L-aspartic acid beta-methyl ester dicyclohexylammonium salt, 95%, Dicyclohexylamine (S)–2–((tert–butoxycarbonyl)amino)–4–methoxy–4–oxobutanoate, Boc-Asp(OMe)-OH·DCHA 97%, Boc-L-aspartic acid beta-methyl ester dicyclohexylammonium salt, 97%, 97%, boc-asp(ome)-oh DCHA salt, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 15g.
N-cyclohexylcyclohexanamine;(2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 135941-84-3) is a chemical compound with the molecular formula C22H40N2O6 and a molecular weight of 428.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: VAZLUTJIPMHAQN-ZCMDIHMWSA-N.
| Molecular formula | C22H40N2O6 |
|---|---|
| Molecular weight | 428.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | VAZLUTJIPMHAQN-ZCMDIHMWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)