Products 135942-11-9
CAS 135942-11-9 appears in our catalog under these names: Triethyl Phosphate-d15, >95% (GC), Triethyl phosphate D15, Triethyl-d15 Phosphate, 99 atom % D, min 98% Chemical Purity, Triethyl phosphatel–d15, Triethyl phosphatel-d15, 99.58%. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 1g, 0,5g, 500mg, 50 mg.
Tris(1,1,2,2,2-pentadeuterioethyl) phosphate (CAS 135942-11-9) is a chemical compound with the molecular formula C6H15O4P and a molecular weight of 197.25 g/mol. IUPAC name: tris(1,1,2,2,2-pentadeuterioethyl) phosphate. InChIKey: DQWPFSLDHJDLRL-NLBPYYKNSA-N.
| Molecular formula | C6H15O4P |
|---|---|
| Molecular weight | 197.25 g/mol |
| IUPAC name | tris(1,1,2,2,2-pentadeuterioethyl) phosphate |
| InChIKey | DQWPFSLDHJDLRL-NLBPYYKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=O)(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)