CAS 135962-97-9 is the registry number for 3-(Dichloromethyl)-1,2,4,5-tetramethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(dichloromethyl)-1,2,4,5-tetramethylbenzene (CAS 135962-97-9) is a chemical compound with the molecular formula C11H14Cl2 and a molecular weight of 217.13 g/mol. IUPAC name: 3-(dichloromethyl)-1,2,4,5-tetramethylbenzene. InChIKey: CCYHIHIYFMEOIN-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 3-(dichloromethyl)-1,2,4,5-tetramethylbenzene |
| InChIKey | CCYHIHIYFMEOIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)C(Cl)Cl)C)C |
Computed by PubChem (NCBI)