CAS 1359703-22-2 is the registry number for 5,7-Dibromochroman-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5,7-dibromo-3,4-dihydro-2H-chromen-4-amine (CAS 1359703-22-2) is a chemical compound with the molecular formula C9H9Br2NO and a molecular weight of 306.98 g/mol. IUPAC name: 5,7-dibromo-3,4-dihydro-2H-chromen-4-amine. InChIKey: CAOLVCMMOQJLSX-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO |
|---|---|
| Molecular weight | 306.98 g/mol |
| IUPAC name | 5,7-dibromo-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | CAOLVCMMOQJLSX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)