Products 1359721-83-7
CAS 1359721-83-7 appears in our catalog under these names: (±)19(20)-EpDTE, (±)19(20)–EpDTE, (±)19(20)-Epdte. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 100μg, 25μg, 50μg, 1mg, 25 μg.
(7Z,10Z,13Z,16Z)-18-[(2S,3R)-3-ethyloxiran-2-yl]octadeca-7,10,13,16-tetraenoic acid (CAS 1359721-83-7) is a chemical compound with the molecular formula C22H34O3 and a molecular weight of 346.5 g/mol. IUPAC name: (7Z,10Z,13Z,16Z)-18-[(2S,3R)-3-ethyloxiran-2-yl]octadeca-7,10,13,16-tetraenoic acid. InChIKey: LKOFAUCMWTWGQQ-SPPFMMLASA-N.
| Molecular formula | C22H34O3 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | (7Z,10Z,13Z,16Z)-18-[(2S,3R)-3-ethyloxiran-2-yl]octadeca-7,10,13,16-tetraenoic acid |
| InChIKey | LKOFAUCMWTWGQQ-SPPFMMLASA-N |
| SMILES | CC[C@@H]1[C@@H](O1)C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)O |
Computed by PubChem (NCBI)