CAS 135984-68-8 is the registry number for Heptadecafluorodecanal. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal (CAS 135984-68-8) is a chemical compound with the molecular formula C10H3F17O and a molecular weight of 462.10 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal. InChIKey: KDGIOTBLYAPNRR-UHFFFAOYSA-N.
| Molecular formula | C10H3F17O |
|---|---|
| Molecular weight | 462.10 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal |
| InChIKey | KDGIOTBLYAPNRR-UHFFFAOYSA-N |
| SMILES | C(C=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)