Products 1359944-60-7
CAS 1359944-60-7 appears in our catalog under these names: MRT-83 hydrochloride, MRT–83 hydrochloride, MRT-83 (hydrochloride), 99.60%, MRT-83 (hydrochloride), 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 10 mg.
3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride (CAS 1359944-60-7) is a chemical compound with the molecular formula C31H31ClN4O5 and a molecular weight of 575.1 g/mol. IUPAC name: 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride. InChIKey: ZOQUUTBPNBYISX-UHFFFAOYSA-N.
| Molecular formula | C31H31ClN4O5 |
|---|---|
| Molecular weight | 575.1 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-[N'-[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamimidoyl]benzamide;hydrochloride |
| InChIKey | ZOQUUTBPNBYISX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=C(N)NC(=O)C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)
Synonyms:
orb1691788