CAS 136-69-6 appears in our catalog under these names: Protokylol Hydrochloride(Mixture of Diastereomers), Protokylol (hydrochloride), 99.07%. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1 mg, 5 mg, 10 mg.
4-[2-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol;hydrochloride (CAS 136-69-6) is a chemical compound with the molecular formula C18H22ClNO5 and a molecular weight of 367.8 g/mol. IUPAC name: 4-[2-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol;hydrochloride. InChIKey: LOVXREQUMZKFCM-UHFFFAOYSA-N.
| Molecular formula | C18H22ClNO5 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 4-[2-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol;hydrochloride |
| InChIKey | LOVXREQUMZKFCM-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)NCC(C3=CC(=C(C=C3)O)O)O.Cl |
Computed by PubChem (NCBI)