Products 136010-41-8
CAS 136010-41-8 is the registry number for (S)-2-Amino-3-(thiazol-4-yl)propanoic acid dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(1,3-thiazol-4-yl)propanoic acid (CAS 136010-41-8) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. IUPAC name: (2S)-2-amino-3-(1,3-thiazol-4-yl)propanoic acid. InChIKey: WBZIGVCQRXJYQD-YFKPBYRVSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | (2S)-2-amino-3-(1,3-thiazol-4-yl)propanoic acid |
| InChIKey | WBZIGVCQRXJYQD-YFKPBYRVSA-N |
| SMILES | C1=C(N=CS1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
L-4-Thiazolylalanine, Thiazolylalanine, l-Thiazolylalanine, Thiazolylalanine, l, THIAZOLYLALANINE [INCI], 4-Thiazolepropanoic acid, alpha-amino-, (S)-, 3-(4-Thiazolyl)-L-alanine, (S)-2-Amino-3-(thiazol-4-yl)propanoic acid, (2S)-2-amino-3-(1,3-thiazol-4-yl)propanoic acid, 3-(1,3-thiazol-4-yl)-L-alanine