Products 1360243-08-8
CAS 1360243-08-8 is the registry number for LabMol-301. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-amino-3-pyridinyl)-N-(pyridin-3-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (CAS 1360243-08-8) is a chemical compound with the molecular formula C18H16N6 and a molecular weight of 316.4 g/mol. IUPAC name: 4-(4-amino-3-pyridinyl)-N-(pyridin-3-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine. InChIKey: YFIFHRUAUGJJAV-UHFFFAOYSA-N.
| Molecular formula | C18H16N6 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 4-(4-amino-3-pyridinyl)-N-(pyridin-3-ylmethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| InChIKey | YFIFHRUAUGJJAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC2=NC3=C(C=CN3)C(=C2)C4=C(C=CN=C4)N |
Computed by PubChem (NCBI)
Synonyms:
LabMol-301, orb1744390