CAS 136042-62-1 is the registry number for 2-(3-Fluoro-4-methylphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-fluoro-4-methylphenyl)benzonitrile (CAS 136042-62-1) is a chemical compound with the molecular formula C14H10FN and a molecular weight of 211.23 g/mol. IUPAC name: 2-(3-fluoro-4-methylphenyl)benzonitrile. InChIKey: QOJOHIJJQKQFGY-UHFFFAOYSA-N.
| Molecular formula | C14H10FN |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | 2-(3-fluoro-4-methylphenyl)benzonitrile |
| InChIKey | QOJOHIJJQKQFGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2C#N)F |
Computed by PubChem (NCBI)