CAS 1360430-70-1 appears in our catalog under these names: N-(3-Chloro-4-fluorophenyl)-7-ethoxy-6-nitroquinazolin-4-amine (Afatinib Impurity), 95%, 95%, Afatinib impurity 83, 95.05%, N-(3-Chloro-4-fluorophenyl)-7-ethoxy-6-nitroquinazolin-4-amine (Afatinib Impurity), 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 50 mg, 25 mg.
N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-nitroquinazolin-4-amine (CAS 1360430-70-1) is a chemical compound with the molecular formula C16H12ClFN4O3 and a molecular weight of 362.74 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-nitroquinazolin-4-amine. InChIKey: JMGHGGXIWOGJQO-UHFFFAOYSA-N.
| Molecular formula | C16H12ClFN4O3 |
|---|---|
| Molecular weight | 362.74 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-nitroquinazolin-4-amine |
| InChIKey | JMGHGGXIWOGJQO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)