CAS 1360461-69-3 appears in our catalog under these names: Benzenemethanaminium, N-[2,3-bis[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]propyl]-4-carboxy-N,N-dimethyl-, inner salt, 99%, DOBAQ 95%, N-(4-carboxybenzyl)-N,N-dimethyl-2,3-bis(oleoyloxy)propan-1-aminium, 95%, 95%, DOBAQ, DOBAQ, 97.27%. Offered by: Chemat Brand, Ambeed, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 25mg, 100mg, 5 mg, 10 mg.
4-[[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-dimethylazaniumyl]methyl]benzoate (CAS 1360461-69-3) is a chemical compound with the molecular formula C49H83NO6 and a molecular weight of 782.2 g/mol. IUPAC name: 4-[[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-dimethylazaniumyl]methyl]benzoate. InChIKey: NYZTVPYNKWYMIW-WRBBJXAJSA-N.
| Molecular formula | C49H83NO6 |
|---|---|
| Molecular weight | 782.2 g/mol |
| IUPAC name | 4-[[2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-dimethylazaniumyl]methyl]benzoate |
| InChIKey | NYZTVPYNKWYMIW-WRBBJXAJSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)CC1=CC=C(C=C1)C(=O)[O-])OC(=O)CCCCCCC/C=C\CCCCCCCC |
Computed by PubChem (NCBI)