CAS 1360535-15-4 is the registry number for Rivastigmine Impurity 17. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(1S)-1-(dimethylamino)ethyl]phenol (CAS 1360535-15-4) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 4-[(1S)-1-(dimethylamino)ethyl]phenol. InChIKey: BSBYBIFCRACFFD-QMMMGPOBSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | 4-[(1S)-1-(dimethylamino)ethyl]phenol |
| InChIKey | BSBYBIFCRACFFD-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)O)N(C)C |
Computed by PubChem (NCBI)