CAS 1360624-01-6 is the registry number for N-[(2,4-Dichloro-3-isothiocyanatophenyl)methyl]-2,2-dimethylpropanamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[(2,4-dichloro-3-isothiocyanatophenyl)methyl]-2,2-dimethylpropanamide (CAS 1360624-01-6) is a chemical compound with the molecular formula C13H14Cl2N2OS and a molecular weight of 317.2 g/mol. IUPAC name: N-[(2,4-dichloro-3-isothiocyanatophenyl)methyl]-2,2-dimethylpropanamide. InChIKey: HXKDIIVLIUZWNP-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2OS |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | N-[(2,4-dichloro-3-isothiocyanatophenyl)methyl]-2,2-dimethylpropanamide |
| InChIKey | HXKDIIVLIUZWNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCC1=C(C(=C(C=C1)Cl)N=C=S)Cl |
Computed by PubChem (NCBI)