CAS 1360824-57-2 appears in our catalog under these names: Ilaprazole Impurity 11, Ilaprazole Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-(2-chloropyrrol-1-yl)-2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole (CAS 1360824-57-2) is a chemical compound with the molecular formula C19H17ClN4O2S and a molecular weight of 400.9 g/mol. IUPAC name: 6-(2-chloropyrrol-1-yl)-2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole. InChIKey: MZBIPBFZKSOJQO-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN4O2S |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | 6-(2-chloropyrrol-1-yl)-2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole |
| InChIKey | MZBIPBFZKSOJQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)N4C=CC=C4Cl)OC |
Computed by PubChem (NCBI)