Products 202592-23-2
CAS 202592-23-2 appears in our catalog under these names: (+)-JQ1 carboxylic acid, min. 95 %, 10 mg, JQ1 Carboxylic Acid, (+)-JQ1 Carboxylic Acid, JQ-1 (carboxylic acid)/ 99.39% (existing batch purity), JQ–1 carboxylic acid. Offered by: Roth, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 10mg, on request, 50mg, 5mg, 25mg, 100mg, 200mg, 250mg.
2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (CAS 202592-23-2) is a chemical compound with the molecular formula C19H17ClN4O2S and a molecular weight of 400.9 g/mol. IUPAC name: 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid. InChIKey: LJOSBOOJFIRCSO-AWEZNQCLSA-N.
| Molecular formula | C19H17ClN4O2S |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | 2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| InChIKey | LJOSBOOJFIRCSO-AWEZNQCLSA-N |
| SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)O)C4=CC=C(C=C4)Cl)C |
Computed by PubChem (NCBI)