CAS 1360869-67-5 is the registry number for 1,6–Dibromo–3,8–diethylpyrene. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1,6-dibromo-3,8-diethylpyrene (CAS 1360869-67-5) is a chemical compound with the molecular formula C20H16Br2 and a molecular weight of 416.1 g/mol. IUPAC name: 1,6-dibromo-3,8-diethylpyrene. InChIKey: OEQLAFPMVXVPAA-UHFFFAOYSA-N.
| Molecular formula | C20H16Br2 |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | 1,6-dibromo-3,8-diethylpyrene |
| InChIKey | OEQLAFPMVXVPAA-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3CC)Br)Br |
Computed by PubChem (NCBI)