CAS 1360884-92-9 is the registry number for 5-Methyl-1H-indazole-7-carbonitrile. Offered by: TRC. Available pack sizes: 250mg.
5-methyl-1H-indazole-7-carbonitrile (CAS 1360884-92-9) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 5-methyl-1H-indazole-7-carbonitrile. InChIKey: GCFACGWYGHGTHX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 5-methyl-1H-indazole-7-carbonitrile |
| InChIKey | GCFACGWYGHGTHX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)C#N)NN=C2 |
Computed by PubChem (NCBI)