CAS 136090-96-5 is the registry number for 2-(Aminomethyl)-1-phenylcyclopropanecarboxamide. Offered by: TRC. Available pack sizes: 100mg.
2-(aminomethyl)-1-phenylcyclopropane-1-carboxamide (CAS 136090-96-5) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 2-(aminomethyl)-1-phenylcyclopropane-1-carboxamide. InChIKey: LMECNVOGESXMGV-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2-(aminomethyl)-1-phenylcyclopropane-1-carboxamide |
| InChIKey | LMECNVOGESXMGV-UHFFFAOYSA-N |
| SMILES | C1C(C1(C2=CC=CC=C2)C(=O)N)CN |
Computed by PubChem (NCBI)