Products 136091-68-4
CAS 136091-68-4 appears in our catalog under these names: 4-Bromo-1-butanol-d8, 4-Bromo-1-butanol-1,1,2,2,3,3,4,4-d8, 99 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,25g, 0,1g.
4-bromo-1,1,2,2,3,3,4,4-octadeuteriobutan-1-ol (CAS 136091-68-4) is a chemical compound with the molecular formula C4H9BrO and a molecular weight of 161.07 g/mol. IUPAC name: 4-bromo-1,1,2,2,3,3,4,4-octadeuteriobutan-1-ol. InChIKey: SIJLYRDVTMMSIP-SVYQBANQSA-N.
| Molecular formula | C4H9BrO |
|---|---|
| Molecular weight | 161.07 g/mol |
| IUPAC name | 4-bromo-1,1,2,2,3,3,4,4-octadeuteriobutan-1-ol |
| InChIKey | SIJLYRDVTMMSIP-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])Br)C([2H])([2H])O |
Computed by PubChem (NCBI)