Products 136091-75-3
CAS 136091-75-3 appears in our catalog under these names: 4-Bromobutyric-2,2,3,3,4,4-d6 acid, 98 atom % D, min 98% Chemical Purity, 4-Bromobutanoic acid-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, Get quote.
4-bromo-2,2,3,3,4,4-hexadeuteriobutanoic acid (CAS 136091-75-3) is a chemical compound with the molecular formula C4H7BrO2 and a molecular weight of 173.04 g/mol. IUPAC name: 4-bromo-2,2,3,3,4,4-hexadeuteriobutanoic acid. InChIKey: GRHQDJDRGZFIPO-NMFSSPJFSA-N.
| Molecular formula | C4H7BrO2 |
|---|---|
| Molecular weight | 173.04 g/mol |
| IUPAC name | 4-bromo-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| InChIKey | GRHQDJDRGZFIPO-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)