CAS 1360916-81-9 is the registry number for 4-Fluoro-3,7-dimethyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-3,7-dimethyl-1H-indole (CAS 1360916-81-9) is a chemical compound with the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. IUPAC name: 4-fluoro-3,7-dimethyl-1H-indole. InChIKey: WVWDBTDZDCKOEK-UHFFFAOYSA-N.
| Molecular formula | C10H10FN |
|---|---|
| Molecular weight | 163.19 g/mol |
| IUPAC name | 4-fluoro-3,7-dimethyl-1H-indole |
| InChIKey | WVWDBTDZDCKOEK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C(=CN2)C |
Computed by PubChem (NCBI)