CAS 1360935-49-4 appears in our catalog under these names: 7'-Bromospiro[cyclopropane-1,3'-indolin]-2'-one, 95%, 7'-Bromospiro(cyclopropane-1,3'-indolin)-2'-one, 95%, 7'–BROMOSPIRO(CYCLOPROPANE–1,3'–INDOLIN)–2'–ONE, 7'-Bromo-1'H-spiro(cyclopropane-1,3'-indole)-2'-one. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
7-bromospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 1360935-49-4) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: RTMUNQFNYDTPSL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | RTMUNQFNYDTPSL-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C(=CC=C3)Br)NC2=O |
Computed by PubChem (NCBI)